C12H15I2NO3 — CID 163577705
(4-oxo-1-adamantyl) 2-amino-2,2-diiodoacetate (PubChem CID 163577705) has the molecular formula C12H15I2NO3 and a molecular weight of 475.06 g/mol. Its IUPAC name is (4-oxo-1-adamantyl) 2-amino-2,2-diiodoacetate.
| Compound Name | (4-oxo-1-adamantyl) 2-amino-2,2-diiodoacetate |
|---|---|
| PubChem CID | 163577705 |
| Molecular Formula | C12H15I2NO3 |
| Molecular Weight | 475.06 g/mol |
| Exact Mass | 474.91 |
| IUPAC Name | (4-oxo-1-adamantyl) 2-amino-2,2-diiodoacetate |
| SMILES | NC(I)(I)C(=O)OC12CC3CC(C1)C(=O)C(C3)C2 |
| InChI | InChI=1S/C12H15I2NO3/c13-12(14,15)10(17)18-11-3-6-1-7(4-11)9(16)8(2-6)5-11/h6-8H,1-5,15H2 |
| InChIKey | GEXROYJGLGFNPQ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.06 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|