2,4-dioxo-4-[(4-oxo-1-adamantyl)oxy]butanoic acid

C14H16O6 — CID 164747378

IUPAC2,4-dioxo-4-[(4-oxo-1-adamantyl)oxy]butanoic acid
SMILESO=C(CC(=O)C(=O)O)OC12CC3CC(C1)C(=O)C(C3)C2
InChIInChI=1S/C14H16O6/c15-10(13(18)19)3-11(16)20-14-4-7-1-8(5-14)12(17)9(2-7)6-14/h7-9H,1-6H2,(H,18,19)
InChIKeyGWFMJQIUNRAAIC-UHFFFAOYSA-N
MW280.28 g/mol
LogP0.72
Rot. Bonds4

About 2,4-dioxo-4-[(4-oxo-1-adamantyl)oxy]butanoic acid

2,4-dioxo-4-[(4-oxo-1-adamantyl)oxy]butanoic acid (PubChem CID 164747378) has the molecular formula C14H16O6 and a molecular weight of 280.28 g/mol. Its IUPAC name is 2,4-dioxo-4-[(4-oxo-1-adamantyl)oxy]butanoic acid.

Molecular Properties

Compound Name2,4-dioxo-4-[(4-oxo-1-adamantyl)oxy]butanoic acid
PubChem CID164747378
Molecular FormulaC14H16O6
Molecular Weight280.28 g/mol
Exact Mass280.09
IUPAC Name2,4-dioxo-4-[(4-oxo-1-adamantyl)oxy]butanoic acid
SMILESO=C(CC(=O)C(=O)O)OC12CC3CC(C1)C(=O)C(C3)C2
InChIInChI=1S/C14H16O6/c15-10(13(18)19)3-11(16)20-14-4-7-1-8(5-14)12(17)9(2-7)6-14/h7-9H,1-6H2,(H,18,19)
InChIKeyGWFMJQIUNRAAIC-UHFFFAOYSA-N
XLogP0.72
TPSA97.74 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500280.28
LogP ≤ 50.72
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 2,4-dioxo-4-[(4-oxo-1-adamantyl)oxy]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4-dioxo-4-[(4-oxo-1-adamantyl)oxy]butanoic acid?
The IUPAC name of 2,4-dioxo-4-[(4-oxo-1-adamantyl)oxy]butanoic acid (CID 164747378) is 2,4-dioxo-4-[(4-oxo-1-adamantyl)oxy]butanoic acid.
What is the SMILES notation for 2,4-dioxo-4-[(4-oxo-1-adamantyl)oxy]butanoic acid?
The canonical SMILES for 2,4-dioxo-4-[(4-oxo-1-adamantyl)oxy]butanoic acid is O=C(CC(=O)C(=O)O)OC12CC3CC(C1)C(=O)C(C3)C2.
What is the InChIKey of 2,4-dioxo-4-[(4-oxo-1-adamantyl)oxy]butanoic acid?
The InChIKey is GWFMJQIUNRAAIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O6/c15-10(13(18)19)3-11(16)20-14-4-7-1-8(5-14)12(17)9(2-7)6-14/h7-9H,1-6H2,(H,18,19).
What are the key properties of 2,4-dioxo-4-[(4-oxo-1-adamantyl)oxy]butanoic acid?
2,4-dioxo-4-[(4-oxo-1-adamantyl)oxy]butanoic acid has a molecular weight of 280.28 g/mol, XLogP of 0.72, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dioxo-4-[(4-oxo-1-adamantyl)oxy]butanoic acid is sourced from PubChem (CID 164747378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).