C37H39F6O15S3- — CID 58122767
(4-oxo-1-adamantyl) 2-[bis[[1,1-difluoro-2-oxo-2-[(4-oxo-1-adamantyl)oxy]ethyl]sulfonyl]methylsulfonyl]-2,2-difluoroacetate (PubChem CID 58122767) has the molecular formula C37H39F6O15S3- and a molecular weight of 933.89 g/mol. Its IUPAC name is (4-oxo-1-adamantyl) 2-[bis[[1,1-difluoro-2-oxo-2-[(4-oxo-1-adamantyl)oxy]ethyl]sulfonyl]methylsulfonyl]-2,2-difluoroacetate.
| Compound Name | (4-oxo-1-adamantyl) 2-[bis[[1,1-difluoro-2-oxo-2-[(4-oxo-1-adamantyl)oxy]ethyl]sulfonyl]methylsulfonyl]-2,2-difluoroacetate |
|---|---|
| PubChem CID | 58122767 |
| Molecular Formula | C37H39F6O15S3- |
| Molecular Weight | 933.89 g/mol |
| Exact Mass | 933.14 |
| IUPAC Name | (4-oxo-1-adamantyl) 2-[bis[[1,1-difluoro-2-oxo-2-[(4-oxo-1-adamantyl)oxy]ethyl]sulfonyl]methylsulfonyl]-2,2-difluoroacetate |
| SMILES | O=C1C2CC3CC1CC(OC(=O)C(F)(F)S(=O)(=O)[C-](S(=O)(=O)C(F)(F)C(=O)OC14CC5CC(C1)C(=O)C(C5)C4)S(=O)(=O)C(F)(F)C(=O)OC14CC5CC(C1)C(=O)C(C5)C4)(C3)C2 |
| InChI | InChI=1S/C37H39F6O15S3/c38-35(39,28(47)56-32-7-16-1-19(10-32)25(44)20(2-16)11-32)59(50,51)31(60(52,53)36(40,41)29(48)57-33-8-17-3-21(12-33)26(45)22(4-17)13-33)61(54,55)37(42,43)30(49)58-34-9-18-5-23(14-34)27(46)24(6-18)15-34/h16-24H,1-15H2/q-1 |
| InChIKey | NRPRFZXMUZUQFO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 232.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 933.89 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|