C17H22F2O9S — CID 89409803
1,1-difluoro-2-[3-hydroxy-3-methyl-4-oxo-4-[(4-oxo-1-adamantyl)oxy]butan-2-yl]oxy-2-oxoethanesulfonic acid (PubChem CID 89409803) has the molecular formula C17H22F2O9S and a molecular weight of 440.42 g/mol. Its IUPAC name is 1,1-difluoro-2-[3-hydroxy-3-methyl-4-oxo-4-[(4-oxo-1-adamantyl)oxy]butan-2-yl]oxy-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[3-hydroxy-3-methyl-4-oxo-4-[(4-oxo-1-adamantyl)oxy]butan-2-yl]oxy-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 89409803 |
| Molecular Formula | C17H22F2O9S |
| Molecular Weight | 440.42 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | 1,1-difluoro-2-[3-hydroxy-3-methyl-4-oxo-4-[(4-oxo-1-adamantyl)oxy]butan-2-yl]oxy-2-oxoethanesulfonic acid |
| SMILES | CC(OC(=O)C(F)(F)S(=O)(=O)O)C(C)(O)C(=O)OC12CC3CC(C1)C(=O)C(C3)C2 |
| InChI | InChI=1S/C17H22F2O9S/c1-8(27-14(22)17(18,19)29(24,25)26)15(2,23)13(21)28-16-5-9-3-10(6-16)12(20)11(4-9)7-16/h8-11,23H,3-7H2,1-2H3,(H,24,25,26) |
| InChIKey | MIUIOSOYQBFXRM-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 144.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.42 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|