C15H20F2O6S — CID 129190188
1,1-difluoro-2-oxo-2-[3-(4-oxo-1-adamantyl)propoxy]ethanesulfonic acid (PubChem CID 129190188) has the molecular formula C15H20F2O6S and a molecular weight of 366.38 g/mol. Its IUPAC name is 1,1-difluoro-2-oxo-2-[3-(4-oxo-1-adamantyl)propoxy]ethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-oxo-2-[3-(4-oxo-1-adamantyl)propoxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 129190188 |
| Molecular Formula | C15H20F2O6S |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 1,1-difluoro-2-oxo-2-[3-(4-oxo-1-adamantyl)propoxy]ethanesulfonic acid |
| SMILES | O=C1C2CC3CC1CC(CCCOC(=O)C(F)(F)S(=O)(=O)O)(C3)C2 |
| InChI | InChI=1S/C15H20F2O6S/c16-15(17,24(20,21)22)13(19)23-3-1-2-14-6-9-4-10(7-14)12(18)11(5-9)8-14/h9-11H,1-8H2,(H,20,21,22) |
| InChIKey | QCGVICJEEMULIW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|