C15H20F2O3 — CID 138600715
2-(4-oxo-1-adamantyl)ethyl 2,2-difluoropropanoate (PubChem CID 138600715) has the molecular formula C15H20F2O3 and a molecular weight of 286.32 g/mol. Its IUPAC name is 2-(4-oxo-1-adamantyl)ethyl 2,2-difluoropropanoate.
| Compound Name | 2-(4-oxo-1-adamantyl)ethyl 2,2-difluoropropanoate |
|---|---|
| PubChem CID | 138600715 |
| Molecular Formula | C15H20F2O3 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 2-(4-oxo-1-adamantyl)ethyl 2,2-difluoropropanoate |
| SMILES | CC(F)(F)C(=O)OCCC12CC3CC(C1)C(=O)C(C3)C2 |
| InChI | InChI=1S/C15H20F2O3/c1-14(16,17)13(19)20-3-2-15-6-9-4-10(7-15)12(18)11(5-9)8-15/h9-11H,2-8H2,1H3 |
| InChIKey | DBBOMDSKNMOCND-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |