C15H22F2O5S — CID 170110105
5-[[1,1-difluoro-2-methyl-2-(trioxidanylsulfanyl)propoxy]methyl]adamantan-2-one (PubChem CID 170110105) has the molecular formula C15H22F2O5S and a molecular weight of 352.40 g/mol. Its IUPAC name is 5-[[1,1-difluoro-2-methyl-2-(trioxidanylsulfanyl)propoxy]methyl]adamantan-2-one.
| Compound Name | 5-[[1,1-difluoro-2-methyl-2-(trioxidanylsulfanyl)propoxy]methyl]adamantan-2-one |
|---|---|
| PubChem CID | 170110105 |
| Molecular Formula | C15H22F2O5S |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 5-[[1,1-difluoro-2-methyl-2-(trioxidanylsulfanyl)propoxy]methyl]adamantan-2-one |
| SMILES | CC(C)(SOOO)C(F)(F)OCC12CC3CC(C1)C(=O)C(C3)C2 |
| InChI | InChI=1S/C15H22F2O5S/c1-13(2,23-22-21-19)15(16,17)20-8-14-5-9-3-10(6-14)12(18)11(4-9)7-14/h9-11,19H,3-8H2,1-2H3 |
| InChIKey | ZPXCIDATBYDFGN-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|