C26H41NO4S — CID 59349917
N,N-bis(1-adamantylmethyl)-2-methyl-2-(trioxidanylsulfanyl)propanamide (PubChem CID 59349917) has the molecular formula C26H41NO4S and a molecular weight of 463.68 g/mol. Its IUPAC name is N,N-bis(1-adamantylmethyl)-2-methyl-2-(trioxidanylsulfanyl)propanamide.
| Compound Name | N,N-bis(1-adamantylmethyl)-2-methyl-2-(trioxidanylsulfanyl)propanamide |
|---|---|
| PubChem CID | 59349917 |
| Molecular Formula | C26H41NO4S |
| Molecular Weight | 463.68 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | N,N-bis(1-adamantylmethyl)-2-methyl-2-(trioxidanylsulfanyl)propanamide |
| SMILES | CC(C)(SOOO)C(=O)N(CC12CC3CC(CC(C3)C1)C2)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C26H41NO4S/c1-24(2,32-31-30-29)23(28)27(15-25-9-17-3-18(10-25)5-19(4-17)11-25)16-26-12-20-6-21(13-26)8-22(7-20)14-26/h17-22,29H,3-16H2,1-2H3 |
| InChIKey | VZGTYQKKFXWWNI-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.68 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|