C45H66O11 — CID 90761725
2,3-dihydro-1H-inden-2-yloxymethyl 2,2-dimethylbutanoate;(3-hydroxy-1-adamantyl) 2,2-dimethylbutanoate;(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) 2,2-dimethylbutanoate (PubChem CID 90761725) has the molecular formula C45H66O11 and a molecular weight of 783.01 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-2-yloxymethyl 2,2-dimethylbutanoate;(3-hydroxy-1-adamantyl) 2,2-dimethylbutanoate;(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) 2,2-dimethylbutanoate.
| Compound Name | 2,3-dihydro-1H-inden-2-yloxymethyl 2,2-dimethylbutanoate;(3-hydroxy-1-adamantyl) 2,2-dimethylbutanoate;(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 90761725 |
| Molecular Formula | C45H66O11 |
| Molecular Weight | 783.01 g/mol |
| Exact Mass | 782.46 |
| IUPAC Name | 2,3-dihydro-1H-inden-2-yloxymethyl 2,2-dimethylbutanoate;(3-hydroxy-1-adamantyl) 2,2-dimethylbutanoate;(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC12CC3CC(CC(O)(C3)C1)C2.CCC(C)(C)C(=O)OC1C2CC3C(=O)OC1C3O2.CCC(C)(C)C(=O)OCOC1Cc2ccccc2C1 |
| InChI | InChI=1S/C16H26O3.C16H22O3.C13H18O5/c1-4-14(2,3)13(17)19-16-8-11-5-12(9-16)7-15(18,6-11)10-16;1-4-16(2,3)15(17)19-11-18-14-9-12-7-5-6-8-13(12)10-14;1-4-13(2,3)12(15)18-9-7-5-6-8(16-7)10(9)17-11(6)14/h11-12,18H,4-10H2,1-3H3;5-8,14H,4,9-11H2,1-3H3;6-10H,4-5H2,1-3H3 |
| InChIKey | OQVLKBMRZORWJM-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 143.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.01 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|