C42H68O10 — CID 91128936
(1-ethylcyclopentyl) 2,2-dimethylbutanoate;(3-hydroxy-1-adamantyl) 2,2-dimethylbutanoate;(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) 2,2-dimethylbutanoate (PubChem CID 91128936) has the molecular formula C42H68O10 and a molecular weight of 733.00 g/mol. Its IUPAC name is (1-ethylcyclopentyl) 2,2-dimethylbutanoate;(3-hydroxy-1-adamantyl) 2,2-dimethylbutanoate;(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) 2,2-dimethylbutanoate.
| Compound Name | (1-ethylcyclopentyl) 2,2-dimethylbutanoate;(3-hydroxy-1-adamantyl) 2,2-dimethylbutanoate;(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 91128936 |
| Molecular Formula | C42H68O10 |
| Molecular Weight | 733.00 g/mol |
| Exact Mass | 732.48 |
| IUPAC Name | (1-ethylcyclopentyl) 2,2-dimethylbutanoate;(3-hydroxy-1-adamantyl) 2,2-dimethylbutanoate;(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC12CC3CC(CC(O)(C3)C1)C2.CCC(C)(C)C(=O)OC1C2CC3C(=O)OC1C3O2.CCC1(OC(=O)C(C)(C)CC)CCCC1 |
| InChI | InChI=1S/C16H26O3.C13H18O5.C13H24O2/c1-4-14(2,3)13(17)19-16-8-11-5-12(9-16)7-15(18,6-11)10-16;1-4-13(2,3)12(15)18-9-7-5-6-8(16-7)10(9)17-11(6)14;1-5-12(3,4)11(14)15-13(6-2)9-7-8-10-13/h11-12,18H,4-10H2,1-3H3;6-10H,4-5H2,1-3H3;5-10H2,1-4H3 |
| InChIKey | YAUTXBHUAXTNPX-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.00 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|