C38H41F5O7S2 — CID 161020215
6-(adamantane-1-carbonyloxy)-2,2-difluorohexane-1-sulfonate;diphenyl-[4-(3,3,3-trifluoropropanoyloxy)phenyl]sulfanium (PubChem CID 161020215) has the molecular formula C38H41F5O7S2 and a molecular weight of 768.86 g/mol. Its IUPAC name is 6-(adamantane-1-carbonyloxy)-2,2-difluorohexane-1-sulfonate;diphenyl-[4-(3,3,3-trifluoropropanoyloxy)phenyl]sulfanium.
| Compound Name | 6-(adamantane-1-carbonyloxy)-2,2-difluorohexane-1-sulfonate;diphenyl-[4-(3,3,3-trifluoropropanoyloxy)phenyl]sulfanium |
|---|---|
| PubChem CID | 161020215 |
| Molecular Formula | C38H41F5O7S2 |
| Molecular Weight | 768.86 g/mol |
| Exact Mass | 768.22 |
| IUPAC Name | 6-(adamantane-1-carbonyloxy)-2,2-difluorohexane-1-sulfonate;diphenyl-[4-(3,3,3-trifluoropropanoyloxy)phenyl]sulfanium |
| SMILES | O=C(CC(F)(F)F)Oc1ccc([S+](c2ccccc2)c2ccccc2)cc1.O=C(OCCCCC(F)(F)CS(=O)(=O)[O-])C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H16F3O2S.C17H26F2O5S/c22-21(23,24)15-20(25)26-16-11-13-19(14-12-16)27(17-7-3-1-4-8-17)18-9-5-2-6-10-18;18-17(19,11-25(21,22)23)3-1-2-4-24-15(20)16-8-12-5-13(9-16)7-14(6-12)10-16/h1-14H,15H2;12-14H,1-11H2,(H,21,22,23)/q+1;/p-1 |
| InChIKey | TYGNRAUFNZUCNW-UHFFFAOYSA-M |
| XLogP | 8.74 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.86 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|