C23H23F2O5S- — CID 140875297
2-(16-tert-butyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl)oxy-1,1-difluoroethanesulfonate (PubChem CID 140875297) has the molecular formula C23H23F2O5S- and a molecular weight of 449.50 g/mol. Its IUPAC name is 2-(16-tert-butyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl)oxy-1,1-difluoroethanesulfonate.
| Compound Name | 2-(16-tert-butyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl)oxy-1,1-difluoroethanesulfonate |
|---|---|
| PubChem CID | 140875297 |
| Molecular Formula | C23H23F2O5S- |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 2-(16-tert-butyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl)oxy-1,1-difluoroethanesulfonate |
| SMILES | CC(C)(C)C1C2c3ccccc3C(c3ccccc32)C1C(=O)OCC(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C23H24F2O5S/c1-22(2,3)20-18-15-10-6-4-8-13(15)17(14-9-5-7-11-16(14)18)19(20)21(26)30-12-23(24,25)31(27,28)29/h4-11,17-20H,12H2,1-3H3,(H,27,28,29)/p-1 |
| InChIKey | HQZPRPIHDHNXJC-UHFFFAOYSA-M |
| XLogP | 4.24 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|