C29H23F4O7S- — CID 176879883
4-[2-(16-tert-butyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl)oxyacetyl]oxy-2,3,5,6-tetrafluorobenzenesulfonate (PubChem CID 176879883) has the molecular formula C29H23F4O7S- and a molecular weight of 591.56 g/mol. Its IUPAC name is 4-[2-(16-tert-butyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl)oxyacetyl]oxy-2,3,5,6-tetrafluorobenzenesulfonate.
| Compound Name | 4-[2-(16-tert-butyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl)oxyacetyl]oxy-2,3,5,6-tetrafluorobenzenesulfonate |
|---|---|
| PubChem CID | 176879883 |
| Molecular Formula | C29H23F4O7S- |
| Molecular Weight | 591.56 g/mol |
| Exact Mass | 591.11 |
| IUPAC Name | 4-[2-(16-tert-butyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl)oxyacetyl]oxy-2,3,5,6-tetrafluorobenzenesulfonate |
| SMILES | CC(C)(C)C1C2c3ccccc3C(c3ccccc32)C1C(=O)OCC(=O)Oc1c(F)c(F)c(S(=O)(=O)[O-])c(F)c1F |
| InChI | InChI=1S/C29H24F4O7S/c1-29(2,3)21-19-15-10-6-4-8-13(15)18(14-9-5-7-11-16(14)19)20(21)28(35)39-12-17(34)40-26-22(30)24(32)27(41(36,37)38)25(33)23(26)31/h4-11,18-21H,12H2,1-3H3,(H,36,37,38)/p-1 |
| InChIKey | OUFWLDYMVLEZBD-UHFFFAOYSA-M |
| XLogP | 5.17 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.56 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|