C29H19F5I3O7S- — CID 176589381
1,1-difluoro-2-(trifluoromethyl)-4-[16-(2,4,6-triiodophenoxy)carbonyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl]oxybutane-1-sulfonate (PubChem CID 176589381) has the molecular formula C29H19F5I3O7S- and a molecular weight of 987.23 g/mol. Its IUPAC name is 1,1-difluoro-2-(trifluoromethyl)-4-[16-(2,4,6-triiodophenoxy)carbonyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl]oxybutane-1-sulfonate.
| Compound Name | 1,1-difluoro-2-(trifluoromethyl)-4-[16-(2,4,6-triiodophenoxy)carbonyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl]oxybutane-1-sulfonate |
|---|---|
| PubChem CID | 176589381 |
| Molecular Formula | C29H19F5I3O7S- |
| Molecular Weight | 987.23 g/mol |
| Exact Mass | 986.79 |
| IUPAC Name | 1,1-difluoro-2-(trifluoromethyl)-4-[16-(2,4,6-triiodophenoxy)carbonyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl]oxybutane-1-sulfonate |
| SMILES | O=C(OCCC(C(F)(F)F)C(F)(F)S(=O)(=O)[O-])C1C2c3ccccc3C(c3ccccc32)C1C(=O)Oc1c(I)cc(I)cc1I |
| InChI | InChI=1S/C29H20F5I3O7S/c30-28(31,32)20(29(33,34)45(40,41)42)9-10-43-26(38)23-21-14-5-1-3-7-16(14)22(17-8-4-2-6-15(17)21)24(23)27(39)44-25-18(36)11-13(35)12-19(25)37/h1-8,11-12,20-24H,9-10H2,(H,40,41,42)/p-1 |
| InChIKey | HKJAHEHTKKFVMC-UHFFFAOYSA-M |
| XLogP | 7.18 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 987.23 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|