C32H24F5I2O6S- — CID 176589394
2-[[3-(9,10-dihydroanthracen-9-yl)-4-(2,4-diiodonaphthalen-1-yl)oxy-4-oxobutoxy]methyl]-1,1,3,3,3-pentafluoropropane-1-sulfonate (PubChem CID 176589394) has the molecular formula C32H24F5I2O6S- and a molecular weight of 885.40 g/mol. Its IUPAC name is 2-[[3-(9,10-dihydroanthracen-9-yl)-4-(2,4-diiodonaphthalen-1-yl)oxy-4-oxobutoxy]methyl]-1,1,3,3,3-pentafluoropropane-1-sulfonate.
| Compound Name | 2-[[3-(9,10-dihydroanthracen-9-yl)-4-(2,4-diiodonaphthalen-1-yl)oxy-4-oxobutoxy]methyl]-1,1,3,3,3-pentafluoropropane-1-sulfonate |
|---|---|
| PubChem CID | 176589394 |
| Molecular Formula | C32H24F5I2O6S- |
| Molecular Weight | 885.40 g/mol |
| Exact Mass | 884.93 |
| IUPAC Name | 2-[[3-(9,10-dihydroanthracen-9-yl)-4-(2,4-diiodonaphthalen-1-yl)oxy-4-oxobutoxy]methyl]-1,1,3,3,3-pentafluoropropane-1-sulfonate |
| SMILES | O=C(Oc1c(I)cc(I)c2ccccc12)C(CCOCC(C(F)(F)F)C(F)(F)S(=O)(=O)[O-])C1c2ccccc2Cc2ccccc21 |
| InChI | InChI=1S/C32H25F5I2O6S/c33-31(34,35)27(32(36,37)46(41,42)43)17-44-14-13-24(28-20-9-3-1-7-18(20)15-19-8-2-4-10-21(19)28)30(40)45-29-23-12-6-5-11-22(23)25(38)16-26(29)39/h1-12,16,24,27-28H,13-15,17H2,(H,41,42,43)/p-1 |
| InChIKey | AMCCCSWWDYGUFN-UHFFFAOYSA-M |
| XLogP | 8.03 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 885.40 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|