C24H15F4O6S- — CID 176879590
2,3,5,6-tetrafluoro-4-[15-(hydroxymethyl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl]oxybenzenesulfonate (PubChem CID 176879590) has the molecular formula C24H15F4O6S- and a molecular weight of 507.44 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[15-(hydroxymethyl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl]oxybenzenesulfonate.
| Compound Name | 2,3,5,6-tetrafluoro-4-[15-(hydroxymethyl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl]oxybenzenesulfonate |
|---|---|
| PubChem CID | 176879590 |
| Molecular Formula | C24H15F4O6S- |
| Molecular Weight | 507.44 g/mol |
| Exact Mass | 507.05 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[15-(hydroxymethyl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl]oxybenzenesulfonate |
| SMILES | O=C(Oc1c(F)c(F)c(S(=O)(=O)[O-])c(F)c1F)C1(CO)CC2c3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C24H16F4O6S/c25-17-19(27)22(35(31,32)33)20(28)18(26)21(17)34-23(30)24(10-29)9-15-11-5-1-3-7-13(11)16(24)14-8-4-2-6-12(14)15/h1-8,15-16,29H,9-10H2,(H,31,32,33)/p-1 |
| InChIKey | NJGBBGIGZCTCFX-UHFFFAOYSA-M |
| XLogP | 3.71 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|