C17H13F4O5S- — CID 58364160
4-(4-butan-2-ylbenzoyl)oxy-2,3,5,6-tetrafluorobenzenesulfonate (PubChem CID 58364160) has the molecular formula C17H13F4O5S- and a molecular weight of 405.35 g/mol. Its IUPAC name is 4-(4-butan-2-ylbenzoyl)oxy-2,3,5,6-tetrafluorobenzenesulfonate.
| Compound Name | 4-(4-butan-2-ylbenzoyl)oxy-2,3,5,6-tetrafluorobenzenesulfonate |
|---|---|
| PubChem CID | 58364160 |
| Molecular Formula | C17H13F4O5S- |
| Molecular Weight | 405.35 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | 4-(4-butan-2-ylbenzoyl)oxy-2,3,5,6-tetrafluorobenzenesulfonate |
| SMILES | CCC(C)c1ccc(C(=O)Oc2c(F)c(F)c(S(=O)(=O)[O-])c(F)c2F)cc1 |
| InChI | InChI=1S/C17H14F4O5S/c1-3-8(2)9-4-6-10(7-5-9)17(22)26-15-11(18)13(20)16(27(23,24)25)14(21)12(15)19/h4-8H,3H2,1-2H3,(H,23,24,25)/p-1 |
| InChIKey | BAPZYZSTVOYKRM-UHFFFAOYSA-M |
| XLogP | 3.88 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.35 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|