C21H23F2NO5S — CID 2669904
[(2R)-1-[4-[(2S)-butan-2-yl]anilino]-1-oxopropan-2-yl] 4-(difluoromethylsulfonyl)benzoate (PubChem CID 2669904) has the molecular formula C21H23F2NO5S and a molecular weight of 439.48 g/mol. Its IUPAC name is [(2R)-1-[4-[(2S)-butan-2-yl]anilino]-1-oxopropan-2-yl] 4-(difluoromethylsulfonyl)benzoate.
| Compound Name | [(2R)-1-[4-[(2S)-butan-2-yl]anilino]-1-oxopropan-2-yl] 4-(difluoromethylsulfonyl)benzoate |
|---|---|
| PubChem CID | 2669904 |
| Molecular Formula | C21H23F2NO5S |
| Molecular Weight | 439.48 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | [(2R)-1-[4-[(2S)-butan-2-yl]anilino]-1-oxopropan-2-yl] 4-(difluoromethylsulfonyl)benzoate |
| SMILES | CC[C@H](C)c1ccc(NC(=O)[C@@H](C)OC(=O)c2ccc(S(=O)(=O)C(F)F)cc2)cc1 |
| InChI | InChI=1S/C21H23F2NO5S/c1-4-13(2)15-5-9-17(10-6-15)24-19(25)14(3)29-20(26)16-7-11-18(12-8-16)30(27,28)21(22)23/h5-14,21H,4H2,1-3H3,(H,24,25)/t13-,14+/m0/s1 |
| InChIKey | ZKFIAYXYEGICAS-UONOGXRCSA-N |
| XLogP | 4.38 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.48 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |