C14H17F2NO5S — CID 8951931
[(2R)-1-oxo-1-(propylamino)propan-2-yl] 4-(difluoromethylsulfonyl)benzoate (PubChem CID 8951931) has the molecular formula C14H17F2NO5S and a molecular weight of 349.36 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(propylamino)propan-2-yl] 4-(difluoromethylsulfonyl)benzoate.
| Compound Name | [(2R)-1-oxo-1-(propylamino)propan-2-yl] 4-(difluoromethylsulfonyl)benzoate |
|---|---|
| PubChem CID | 8951931 |
| Molecular Formula | C14H17F2NO5S |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | [(2R)-1-oxo-1-(propylamino)propan-2-yl] 4-(difluoromethylsulfonyl)benzoate |
| SMILES | CCCNC(=O)[C@@H](C)OC(=O)c1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C14H17F2NO5S/c1-3-8-17-12(18)9(2)22-13(19)10-4-6-11(7-5-10)23(20,21)14(15)16/h4-7,9,14H,3,8H2,1-2H3,(H,17,18)/t9-/m1/s1 |
| InChIKey | ZPUZGKHNCZNOEA-SECBINFHSA-N |
| XLogP | 1.75 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |