C23H25N2O4P — CID 102354020
2-diazo-2-dimethoxyphosphoryl-1-(15-propyl-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)ethanone (PubChem CID 102354020) has the molecular formula C23H25N2O4P and a molecular weight of 424.44 g/mol. Its IUPAC name is 2-diazo-2-dimethoxyphosphoryl-1-(15-propyl-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)ethanone.
| Compound Name | 2-diazo-2-dimethoxyphosphoryl-1-(15-propyl-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)ethanone |
|---|---|
| PubChem CID | 102354020 |
| Molecular Formula | C23H25N2O4P |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 2-diazo-2-dimethoxyphosphoryl-1-(15-propyl-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)ethanone |
| SMILES | CCCC1(C(=O)C(=[N+]=[N-])P(=O)(OC)OC)CC2c3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C23H25N2O4P/c1-4-13-23(21(26)22(25-24)30(27,28-2)29-3)14-19-15-9-5-7-11-17(15)20(23)18-12-8-6-10-16(18)19/h5-12,19-20H,4,13-14H2,1-3H3 |
| InChIKey | FEDNCQSSLCWGES-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 89.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|