C24H24O5 — CID 159438128
1-O-ethyl 2-O-(oxiran-2-yl) benzene-1,2-dicarboxylate;1-prop-1-en-2-yl-1H-indene (PubChem CID 159438128) has the molecular formula C24H24O5 and a molecular weight of 392.45 g/mol. Its IUPAC name is 1-O-ethyl 2-O-(oxiran-2-yl) benzene-1,2-dicarboxylate;1-prop-1-en-2-yl-1H-indene.
| Compound Name | 1-O-ethyl 2-O-(oxiran-2-yl) benzene-1,2-dicarboxylate;1-prop-1-en-2-yl-1H-indene |
|---|---|
| PubChem CID | 159438128 |
| Molecular Formula | C24H24O5 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 1-O-ethyl 2-O-(oxiran-2-yl) benzene-1,2-dicarboxylate;1-prop-1-en-2-yl-1H-indene |
| SMILES | C=C(C)C1C=Cc2ccccc21.CCOC(=O)c1ccccc1C(=O)OC1CO1 |
| InChI | InChI=1S/C12H12O5.C12H12/c1-2-15-11(13)8-5-3-4-6-9(8)12(14)17-10-7-16-10;1-9(2)11-8-7-10-5-3-4-6-12(10)11/h3-6,10H,2,7H2,1H3;3-8,11H,1H2,2H3 |
| InChIKey | LRVIWEANOCEAKV-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|