C12H11LiN2O2Se — CID 135052600
lithium ethyl 5-phenylimino-2,4-dihydro-1,3-selenazol-2-ide-4-carboxylate (PubChem CID 135052600) has the molecular formula C12H11LiN2O2Se and a molecular weight of 301.13 g/mol. Its IUPAC name is lithium ethyl 5-phenylimino-2,4-dihydro-1,3-selenazol-2-ide-4-carboxylate.
| Compound Name | lithium ethyl 5-phenylimino-2,4-dihydro-1,3-selenazol-2-ide-4-carboxylate |
|---|---|
| PubChem CID | 135052600 |
| Molecular Formula | C12H11LiN2O2Se |
| Molecular Weight | 301.13 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | lithium ethyl 5-phenylimino-2,4-dihydro-1,3-selenazol-2-ide-4-carboxylate |
| SMILES | CCOC(=O)C1N=[C-][Se]/C1=N\c1ccccc1.[Li+] |
| InChI | InChI=1S/C12H11N2O2Se.Li/c1-2-16-12(15)10-11(17-8-13-10)14-9-6-4-3-5-7-9;/h3-7,10H,2H2,1H3;/q-1;+1/b14-11-; |
| InChIKey | SHFWANXJEOWJJN-IRIIKGHASA-N |
| XLogP | -1.72 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.13 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|