C19H32N2O5Si — CID 91742541
diethyl 1-cyclohexyl-5-oxo-4-(trimethylsilylamino)-2H-pyrrole-2,3-dicarboxylate (PubChem CID 91742541) has the molecular formula C19H32N2O5Si and a molecular weight of 396.56 g/mol. Its IUPAC name is diethyl 1-cyclohexyl-5-oxo-4-(trimethylsilylamino)-2H-pyrrole-2,3-dicarboxylate.
| Compound Name | diethyl 1-cyclohexyl-5-oxo-4-(trimethylsilylamino)-2H-pyrrole-2,3-dicarboxylate |
|---|---|
| PubChem CID | 91742541 |
| Molecular Formula | C19H32N2O5Si |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | diethyl 1-cyclohexyl-5-oxo-4-(trimethylsilylamino)-2H-pyrrole-2,3-dicarboxylate |
| SMILES | CCOC(=O)C1=C(N[Si](C)(C)C)C(=O)N(C2CCCCC2)C1C(=O)OCC |
| InChI | InChI=1S/C19H32N2O5Si/c1-6-25-18(23)14-15(20-27(3,4)5)17(22)21(13-11-9-8-10-12-13)16(14)19(24)26-7-2/h13,16,20H,6-12H2,1-5H3 |
| InChIKey | GHTCZSGICQOGRM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|