C24H20F3NO — CID 177455156
4-methyl-1,4-diphenyl-5-[4-(trifluoromethyl)phenyl]pyrrolidin-2-one (PubChem CID 177455156) has the molecular formula C24H20F3NO and a molecular weight of 395.42 g/mol. Its IUPAC name is 4-methyl-1,4-diphenyl-5-[4-(trifluoromethyl)phenyl]pyrrolidin-2-one.
| Compound Name | 4-methyl-1,4-diphenyl-5-[4-(trifluoromethyl)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 177455156 |
| Molecular Formula | C24H20F3NO |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 4-methyl-1,4-diphenyl-5-[4-(trifluoromethyl)phenyl]pyrrolidin-2-one |
| SMILES | CC1(c2ccccc2)CC(=O)N(c2ccccc2)C1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H20F3NO/c1-23(18-8-4-2-5-9-18)16-21(29)28(20-10-6-3-7-11-20)22(23)17-12-14-19(15-13-17)24(25,26)27/h2-15,22H,16H2,1H3 |
| InChIKey | WBHWMLDPARZGIN-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |