C23H21NO2 — CID 11810064
(3R,4R)-4-(3-methoxyphenyl)-3-methyl-1,3-diphenylazetidin-2-one (PubChem CID 11810064) has the molecular formula C23H21NO2 and a molecular weight of 343.43 g/mol. Its IUPAC name is (3R,4R)-4-(3-methoxyphenyl)-3-methyl-1,3-diphenylazetidin-2-one.
| Compound Name | (3R,4R)-4-(3-methoxyphenyl)-3-methyl-1,3-diphenylazetidin-2-one |
|---|---|
| PubChem CID | 11810064 |
| Molecular Formula | C23H21NO2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | (3R,4R)-4-(3-methoxyphenyl)-3-methyl-1,3-diphenylazetidin-2-one |
| SMILES | COc1cccc([C@H]2N(c3ccccc3)C(=O)[C@]2(C)c2ccccc2)c1 |
| InChI | InChI=1S/C23H21NO2/c1-23(18-11-5-3-6-12-18)21(17-10-9-15-20(16-17)26-2)24(22(23)25)19-13-7-4-8-14-19/h3-16,21H,1-2H3/t21-,23-/m1/s1 |
| InChIKey | RIGLYHMTLMOJAU-FYYLOGMGSA-N |
| XLogP | 4.74 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |