C23H20N3O2+ — CID 11092078
4-[(2R,3R)-2-(4-methoxyphenyl)-3-methyl-4-oxo-1-phenylazetidin-3-yl]benzenediazonium (PubChem CID 11092078) has the molecular formula C23H20N3O2+ and a molecular weight of 370.43 g/mol. Its IUPAC name is 4-[(2R,3R)-2-(4-methoxyphenyl)-3-methyl-4-oxo-1-phenylazetidin-3-yl]benzenediazonium.
| Compound Name | 4-[(2R,3R)-2-(4-methoxyphenyl)-3-methyl-4-oxo-1-phenylazetidin-3-yl]benzenediazonium |
|---|---|
| PubChem CID | 11092078 |
| Molecular Formula | C23H20N3O2+ |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 4-[(2R,3R)-2-(4-methoxyphenyl)-3-methyl-4-oxo-1-phenylazetidin-3-yl]benzenediazonium |
| SMILES | COc1ccc([C@H]2N(c3ccccc3)C(=O)[C@]2(C)c2ccc([N+]#N)cc2)cc1 |
| InChI | InChI=1S/C23H20N3O2/c1-23(17-10-12-18(25-24)13-11-17)21(16-8-14-20(28-2)15-9-16)26(22(23)27)19-6-4-3-5-7-19/h3-15,21H,1-2H3/q+1/t21-,23-/m1/s1 |
| InChIKey | LEHZXNFRWYXDRC-FYYLOGMGSA-N |
| XLogP | 5.23 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|