C25H20F3N3O4 — CID 11092077
4-[(2R,3R)-2-(4-methoxyphenyl)-3-methyl-4-oxo-1-phenylazetidin-3-yl]benzenediazonium;2,2,2-trifluoroacetate (PubChem CID 11092077) has the molecular formula C25H20F3N3O4 and a molecular weight of 483.45 g/mol. Its IUPAC name is 4-[(2R,3R)-2-(4-methoxyphenyl)-3-methyl-4-oxo-1-phenylazetidin-3-yl]benzenediazonium;2,2,2-trifluoroacetate.
| Compound Name | 4-[(2R,3R)-2-(4-methoxyphenyl)-3-methyl-4-oxo-1-phenylazetidin-3-yl]benzenediazonium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 11092077 |
| Molecular Formula | C25H20F3N3O4 |
| Molecular Weight | 483.45 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | 4-[(2R,3R)-2-(4-methoxyphenyl)-3-methyl-4-oxo-1-phenylazetidin-3-yl]benzenediazonium;2,2,2-trifluoroacetate |
| SMILES | COc1ccc([C@H]2N(c3ccccc3)C(=O)[C@]2(C)c2ccc([N+]#N)cc2)cc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C23H20N3O2.C2HF3O2/c1-23(17-10-12-18(25-24)13-11-17)21(16-8-14-20(28-2)15-9-16)26(22(23)27)19-6-4-3-5-7-19;3-2(4,5)1(6)7/h3-15,21H,1-2H3;(H,6,7)/q+1;/p-1/t21-,23-;/m1./s1 |
| InChIKey | YUYYGWQMIBHBNR-BLDCTAJRSA-M |
| XLogP | 4.52 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.45 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|