C20H19NO3 — CID 10687229
methyl (2R,3S)-1-benzoyl-3-phenyl-2-prop-2-enylaziridine-2-carboxylate (PubChem CID 10687229) has the molecular formula C20H19NO3 and a molecular weight of 321.38 g/mol. Its IUPAC name is methyl (2R,3S)-1-benzoyl-3-phenyl-2-prop-2-enylaziridine-2-carboxylate.
| Compound Name | methyl (2R,3S)-1-benzoyl-3-phenyl-2-prop-2-enylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 10687229 |
| Molecular Formula | C20H19NO3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | methyl (2R,3S)-1-benzoyl-3-phenyl-2-prop-2-enylaziridine-2-carboxylate |
| SMILES | C=CC[C@]1(C(=O)OC)[C@H](c2ccccc2)N1C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H19NO3/c1-3-14-20(19(23)24-2)17(15-10-6-4-7-11-15)21(20)18(22)16-12-8-5-9-13-16/h3-13,17H,1,14H2,2H3/t17-,20+,21?/m0/s1 |
| InChIKey | GNAKSIXJRMHEML-DVUUQMMQSA-N |
| XLogP | 3.37 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|