C24H27NO3 — CID 164667919
(3S,4S)-3-benzoyl-1-tert-butyl-4-(4-methoxyphenyl)-3-prop-2-enylazetidin-2-one (PubChem CID 164667919) has the molecular formula C24H27NO3 and a molecular weight of 377.48 g/mol. Its IUPAC name is (3S,4S)-3-benzoyl-1-tert-butyl-4-(4-methoxyphenyl)-3-prop-2-enylazetidin-2-one.
| Compound Name | (3S,4S)-3-benzoyl-1-tert-butyl-4-(4-methoxyphenyl)-3-prop-2-enylazetidin-2-one |
|---|---|
| PubChem CID | 164667919 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | (3S,4S)-3-benzoyl-1-tert-butyl-4-(4-methoxyphenyl)-3-prop-2-enylazetidin-2-one |
| SMILES | C=CC[C@]1(C(=O)c2ccccc2)C(=O)N(C(C)(C)C)[C@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C24H27NO3/c1-6-16-24(21(26)18-10-8-7-9-11-18)20(25(22(24)27)23(2,3)4)17-12-14-19(28-5)15-13-17/h6-15,20H,1,16H2,2-5H3/t20-,24-/m0/s1 |
| InChIKey | ZDTOKBDLQDDMCQ-RDPSFJRHSA-N |
| XLogP | 4.82 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|