C13H12O5 — CID 102094067
(2R,3R)-2-(4-methoxyphenyl)-4-methylidene-5-oxooxolane-3-carboxylic acid (PubChem CID 102094067) has the molecular formula C13H12O5 and a molecular weight of 248.23 g/mol. Its IUPAC name is (2R,3R)-2-(4-methoxyphenyl)-4-methylidene-5-oxooxolane-3-carboxylic acid.
| Compound Name | (2R,3R)-2-(4-methoxyphenyl)-4-methylidene-5-oxooxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 102094067 |
| Molecular Formula | C13H12O5 |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | (2R,3R)-2-(4-methoxyphenyl)-4-methylidene-5-oxooxolane-3-carboxylic acid |
| SMILES | C=C1C(=O)O[C@@H](c2ccc(OC)cc2)[C@@H]1C(=O)O |
| InChI | InChI=1S/C13H12O5/c1-7-10(12(14)15)11(18-13(7)16)8-3-5-9(17-2)6-4-8/h3-6,10-11H,1H2,2H3,(H,14,15)/t10-,11+/m1/s1 |
| InChIKey | XGDRDCZVRYTPQU-MNOVXSKESA-N |
| XLogP | 1.55 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|