C14H14O5 — CID 101100237
methyl (2R,3R)-2-(3-methoxyphenyl)-4-methylidene-5-oxooxolane-3-carboxylate (PubChem CID 101100237) has the molecular formula C14H14O5 and a molecular weight of 262.26 g/mol. Its IUPAC name is methyl (2R,3R)-2-(3-methoxyphenyl)-4-methylidene-5-oxooxolane-3-carboxylate.
| Compound Name | methyl (2R,3R)-2-(3-methoxyphenyl)-4-methylidene-5-oxooxolane-3-carboxylate |
|---|---|
| PubChem CID | 101100237 |
| Molecular Formula | C14H14O5 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | methyl (2R,3R)-2-(3-methoxyphenyl)-4-methylidene-5-oxooxolane-3-carboxylate |
| SMILES | C=C1C(=O)O[C@@H](c2cccc(OC)c2)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C14H14O5/c1-8-11(14(16)18-3)12(19-13(8)15)9-5-4-6-10(7-9)17-2/h4-7,11-12H,1H2,2-3H3/t11-,12+/m1/s1 |
| InChIKey | AHSFNWBMFILPJX-NEPJUHHUSA-N |
| XLogP | 1.64 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|