C16H20O3 — CID 86276435
methyl (1R,2S,3R,4S)-2-ethenyl-1-hydroxy-3-methyl-4-phenylcyclopentane-1-carboxylate (PubChem CID 86276435) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is methyl (1R,2S,3R,4S)-2-ethenyl-1-hydroxy-3-methyl-4-phenylcyclopentane-1-carboxylate.
| Compound Name | methyl (1R,2S,3R,4S)-2-ethenyl-1-hydroxy-3-methyl-4-phenylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 86276435 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | methyl (1R,2S,3R,4S)-2-ethenyl-1-hydroxy-3-methyl-4-phenylcyclopentane-1-carboxylate |
| SMILES | C=C[C@H]1[C@H](C)[C@@H](c2ccccc2)C[C@]1(O)C(=O)OC |
| InChI | InChI=1S/C16H20O3/c1-4-14-11(2)13(12-8-6-5-7-9-12)10-16(14,18)15(17)19-3/h4-9,11,13-14,18H,1,10H2,2-3H3/t11-,13+,14+,16-/m1/s1 |
| InChIKey | QGBZBUGUSYXIEJ-AOLWHUPESA-N |
| XLogP | 2.52 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|