C18H22O3 — CID 100995271
methyl (1S,2R,3aR,4S,6aR)-2-ethenyl-4-hydroxy-1-phenyl-2,3,4,5,6,6a-hexahydro-1H-pentalene-3a-carboxylate (PubChem CID 100995271) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is methyl (1S,2R,3aR,4S,6aR)-2-ethenyl-4-hydroxy-1-phenyl-2,3,4,5,6,6a-hexahydro-1H-pentalene-3a-carboxylate.
| Compound Name | methyl (1S,2R,3aR,4S,6aR)-2-ethenyl-4-hydroxy-1-phenyl-2,3,4,5,6,6a-hexahydro-1H-pentalene-3a-carboxylate |
|---|---|
| PubChem CID | 100995271 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | methyl (1S,2R,3aR,4S,6aR)-2-ethenyl-4-hydroxy-1-phenyl-2,3,4,5,6,6a-hexahydro-1H-pentalene-3a-carboxylate |
| SMILES | C=C[C@H]1C[C@@]2(C(=O)OC)[C@H](CC[C@@H]2O)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H22O3/c1-3-12-11-18(17(20)21-2)14(9-10-15(18)19)16(12)13-7-5-4-6-8-13/h3-8,12,14-16,19H,1,9-11H2,2H3/t12-,14+,15-,16+,18+/m0/s1 |
| InChIKey | VUWLTYTVYATMKZ-RFUJCOMKSA-N |
| XLogP | 2.91 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|