C27H24ClN3O7 — CID 2537865
ethyl (6S)-3-(4-chlorophenyl)-6-[4-(4-methoxyphenoxy)-3-nitrophenyl]-4-methyl-2-oxo-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 2537865) has the molecular formula C27H24ClN3O7 and a molecular weight of 537.96 g/mol. Its IUPAC name is ethyl (6S)-3-(4-chlorophenyl)-6-[4-(4-methoxyphenoxy)-3-nitrophenyl]-4-methyl-2-oxo-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | ethyl (6S)-3-(4-chlorophenyl)-6-[4-(4-methoxyphenoxy)-3-nitrophenyl]-4-methyl-2-oxo-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 2537865 |
| Molecular Formula | C27H24ClN3O7 |
| Molecular Weight | 537.96 g/mol |
| Exact Mass | 537.13 |
| IUPAC Name | ethyl (6S)-3-(4-chlorophenyl)-6-[4-(4-methoxyphenoxy)-3-nitrophenyl]-4-methyl-2-oxo-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N(c2ccc(Cl)cc2)C(=O)N[C@H]1c1ccc(Oc2ccc(OC)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H24ClN3O7/c1-4-37-26(32)24-16(2)30(19-8-6-18(28)7-9-19)27(33)29-25(24)17-5-14-23(22(15-17)31(34)35)38-21-12-10-20(36-3)11-13-21/h5-15,25H,4H2,1-3H3,(H,29,33)/t25-/m0/s1 |
| InChIKey | OFYJNVAEDGNHJN-VWLOTQADSA-N |
| XLogP | 6.16 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.96 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|