C17H18ClN3O5 — CID 9449592
ethyl (6R)-6-(4-chloro-3-nitrophenyl)-4-methyl-2-oxo-3-prop-2-enyl-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 9449592) has the molecular formula C17H18ClN3O5 and a molecular weight of 379.80 g/mol. Its IUPAC name is ethyl (6R)-6-(4-chloro-3-nitrophenyl)-4-methyl-2-oxo-3-prop-2-enyl-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | ethyl (6R)-6-(4-chloro-3-nitrophenyl)-4-methyl-2-oxo-3-prop-2-enyl-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 9449592 |
| Molecular Formula | C17H18ClN3O5 |
| Molecular Weight | 379.80 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | ethyl (6R)-6-(4-chloro-3-nitrophenyl)-4-methyl-2-oxo-3-prop-2-enyl-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | C=CCN1C(=O)N[C@H](c2ccc(Cl)c([N+](=O)[O-])c2)C(C(=O)OCC)=C1C |
| InChI | InChI=1S/C17H18ClN3O5/c1-4-8-20-10(3)14(16(22)26-5-2)15(19-17(20)23)11-6-7-12(18)13(9-11)21(24)25/h4,6-7,9,15H,1,5,8H2,2-3H3,(H,19,23)/t15-/m1/s1 |
| InChIKey | VXCLEIXVFFVSOA-OAHLLOKOSA-N |
| XLogP | 3.34 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.80 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|