C20H19ClN4O5 — CID 51963139
ethyl (6R)-6-(4-chloro-3-nitrophenyl)-4-methyl-2-oxo-3-(pyridin-3-ylmethyl)-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 51963139) has the molecular formula C20H19ClN4O5 and a molecular weight of 430.85 g/mol. Its IUPAC name is ethyl (6R)-6-(4-chloro-3-nitrophenyl)-4-methyl-2-oxo-3-(pyridin-3-ylmethyl)-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | ethyl (6R)-6-(4-chloro-3-nitrophenyl)-4-methyl-2-oxo-3-(pyridin-3-ylmethyl)-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 51963139 |
| Molecular Formula | C20H19ClN4O5 |
| Molecular Weight | 430.85 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | ethyl (6R)-6-(4-chloro-3-nitrophenyl)-4-methyl-2-oxo-3-(pyridin-3-ylmethyl)-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N(Cc2cccnc2)C(=O)N[C@@H]1c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H19ClN4O5/c1-3-30-19(26)17-12(2)24(11-13-5-4-8-22-10-13)20(27)23-18(17)14-6-7-15(21)16(9-14)25(28)29/h4-10,18H,3,11H2,1-2H3,(H,23,27)/t18-/m1/s1 |
| InChIKey | KDPKHGDUWCWZSW-GOSISDBHSA-N |
| XLogP | 3.75 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.85 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|