C24H20ClN3O5 — CID 23096104
ethyl 4-[[(E)-3-(4-chloro-3-nitrophenyl)prop-2-enoyl]-(pyridin-3-ylmethyl)amino]benzoate (PubChem CID 23096104) has the molecular formula C24H20ClN3O5 and a molecular weight of 465.89 g/mol. Its IUPAC name is ethyl 4-[[(E)-3-(4-chloro-3-nitrophenyl)prop-2-enoyl]-(pyridin-3-ylmethyl)amino]benzoate.
| Compound Name | ethyl 4-[[(E)-3-(4-chloro-3-nitrophenyl)prop-2-enoyl]-(pyridin-3-ylmethyl)amino]benzoate |
|---|---|
| PubChem CID | 23096104 |
| Molecular Formula | C24H20ClN3O5 |
| Molecular Weight | 465.89 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | ethyl 4-[[(E)-3-(4-chloro-3-nitrophenyl)prop-2-enoyl]-(pyridin-3-ylmethyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(N(Cc2cccnc2)C(=O)/C=C/c2ccc(Cl)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C24H20ClN3O5/c1-2-33-24(30)19-7-9-20(10-8-19)27(16-18-4-3-13-26-15-18)23(29)12-6-17-5-11-21(25)22(14-17)28(31)32/h3-15H,2,16H2,1H3/b12-6+ |
| InChIKey | PUGWCNAZTGZZMW-WUXMJOGZSA-N |
| XLogP | 5.07 |
| TPSA | 102.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.89 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|