C25H20Cl3NO3 — CID 23098892
ethyl 4-[[(E)-3-(4-chlorophenyl)prop-2-enoyl]-[(2,6-dichlorophenyl)methyl]amino]benzoate (PubChem CID 23098892) has the molecular formula C25H20Cl3NO3 and a molecular weight of 488.80 g/mol. Its IUPAC name is ethyl 4-[[(E)-3-(4-chlorophenyl)prop-2-enoyl]-[(2,6-dichlorophenyl)methyl]amino]benzoate.
| Compound Name | ethyl 4-[[(E)-3-(4-chlorophenyl)prop-2-enoyl]-[(2,6-dichlorophenyl)methyl]amino]benzoate |
|---|---|
| PubChem CID | 23098892 |
| Molecular Formula | C25H20Cl3NO3 |
| Molecular Weight | 488.80 g/mol |
| Exact Mass | 487.05 |
| IUPAC Name | ethyl 4-[[(E)-3-(4-chlorophenyl)prop-2-enoyl]-[(2,6-dichlorophenyl)methyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(N(Cc2c(Cl)cccc2Cl)C(=O)/C=C/c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C25H20Cl3NO3/c1-2-32-25(31)18-9-13-20(14-10-18)29(16-21-22(27)4-3-5-23(21)28)24(30)15-8-17-6-11-19(26)12-7-17/h3-15H,2,16H2,1H3/b15-8+ |
| InChIKey | HUDXXEFHCLKLGM-OVCLIPMQSA-N |
| XLogP | 7.07 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.80 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|