C26H22BrCl2NO4 — CID 21170282
ethyl 4-[[(E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoyl]-[(2,6-dichlorophenyl)methyl]amino]benzoate (PubChem CID 21170282) has the molecular formula C26H22BrCl2NO4 and a molecular weight of 563.28 g/mol. Its IUPAC name is ethyl 4-[[(E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoyl]-[(2,6-dichlorophenyl)methyl]amino]benzoate.
| Compound Name | ethyl 4-[[(E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoyl]-[(2,6-dichlorophenyl)methyl]amino]benzoate |
|---|---|
| PubChem CID | 21170282 |
| Molecular Formula | C26H22BrCl2NO4 |
| Molecular Weight | 563.28 g/mol |
| Exact Mass | 561.01 |
| IUPAC Name | ethyl 4-[[(E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoyl]-[(2,6-dichlorophenyl)methyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(N(Cc2c(Cl)cccc2Cl)C(=O)/C=C/c2cc(Br)ccc2OC)cc1 |
| InChI | InChI=1S/C26H22BrCl2NO4/c1-3-34-26(32)17-7-11-20(12-8-17)30(16-21-22(28)5-4-6-23(21)29)25(31)14-9-18-15-19(27)10-13-24(18)33-2/h4-15H,3,16H2,1-2H3/b14-9+ |
| InChIKey | DWOBLHYYOUZSMB-NTEUORMPSA-N |
| XLogP | 7.19 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.28 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|