C26H21Br2Cl2NO4 — CID 21172360
ethyl 4-[[(E)-3-(3,5-dibromo-2-methoxyphenyl)prop-2-enoyl]-[(2,6-dichlorophenyl)methyl]amino]benzoate (PubChem CID 21172360) has the molecular formula C26H21Br2Cl2NO4 and a molecular weight of 642.17 g/mol. Its IUPAC name is ethyl 4-[[(E)-3-(3,5-dibromo-2-methoxyphenyl)prop-2-enoyl]-[(2,6-dichlorophenyl)methyl]amino]benzoate.
| Compound Name | ethyl 4-[[(E)-3-(3,5-dibromo-2-methoxyphenyl)prop-2-enoyl]-[(2,6-dichlorophenyl)methyl]amino]benzoate |
|---|---|
| PubChem CID | 21172360 |
| Molecular Formula | C26H21Br2Cl2NO4 |
| Molecular Weight | 642.17 g/mol |
| Exact Mass | 638.92 |
| IUPAC Name | ethyl 4-[[(E)-3-(3,5-dibromo-2-methoxyphenyl)prop-2-enoyl]-[(2,6-dichlorophenyl)methyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(N(Cc2c(Cl)cccc2Cl)C(=O)/C=C/c2cc(Br)cc(Br)c2OC)cc1 |
| InChI | InChI=1S/C26H21Br2Cl2NO4/c1-3-35-26(33)16-7-10-19(11-8-16)31(15-20-22(29)5-4-6-23(20)30)24(32)12-9-17-13-18(27)14-21(28)25(17)34-2/h4-14H,3,15H2,1-2H3/b12-9+ |
| InChIKey | YIWCKGBVUKONPX-FMIVXFBMSA-N |
| XLogP | 7.95 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.17 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|