C25H21Cl2NO3 — CID 22783001
ethyl 4-[(2,6-dichlorophenyl)methyl-[(E)-3-phenylprop-2-enoyl]amino]benzoate (PubChem CID 22783001) has the molecular formula C25H21Cl2NO3 and a molecular weight of 454.35 g/mol. Its IUPAC name is ethyl 4-[(2,6-dichlorophenyl)methyl-[(E)-3-phenylprop-2-enoyl]amino]benzoate.
| Compound Name | ethyl 4-[(2,6-dichlorophenyl)methyl-[(E)-3-phenylprop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 22783001 |
| Molecular Formula | C25H21Cl2NO3 |
| Molecular Weight | 454.35 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | ethyl 4-[(2,6-dichlorophenyl)methyl-[(E)-3-phenylprop-2-enoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(N(Cc2c(Cl)cccc2Cl)C(=O)/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C25H21Cl2NO3/c1-2-31-25(30)19-12-14-20(15-13-19)28(17-21-22(26)9-6-10-23(21)27)24(29)16-11-18-7-4-3-5-8-18/h3-16H,2,17H2,1H3/b16-11+ |
| InChIKey | GTIHWVNTJZQNCW-LFIBNONCSA-N |
| XLogP | 6.42 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.35 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|