C23H21ClN2O4 — CID 22778176
ethyl 4-[[2-(4-chlorophenoxy)acetyl]-(pyridin-3-ylmethyl)amino]benzoate (PubChem CID 22778176) has the molecular formula C23H21ClN2O4 and a molecular weight of 424.88 g/mol. Its IUPAC name is ethyl 4-[[2-(4-chlorophenoxy)acetyl]-(pyridin-3-ylmethyl)amino]benzoate.
| Compound Name | ethyl 4-[[2-(4-chlorophenoxy)acetyl]-(pyridin-3-ylmethyl)amino]benzoate |
|---|---|
| PubChem CID | 22778176 |
| Molecular Formula | C23H21ClN2O4 |
| Molecular Weight | 424.88 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | ethyl 4-[[2-(4-chlorophenoxy)acetyl]-(pyridin-3-ylmethyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(N(Cc2cccnc2)C(=O)COc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H21ClN2O4/c1-2-29-23(28)18-5-9-20(10-6-18)26(15-17-4-3-13-25-14-17)22(27)16-30-21-11-7-19(24)8-12-21/h3-14H,2,15-16H2,1H3 |
| InChIKey | BRCCUYFAWRQLGS-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.88 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |