C24H23ClN2O4 — CID 22780966
ethyl 4-[[2-(4-chloro-3-methylphenoxy)acetyl]-(pyridin-4-ylmethyl)amino]benzoate (PubChem CID 22780966) has the molecular formula C24H23ClN2O4 and a molecular weight of 438.91 g/mol. Its IUPAC name is ethyl 4-[[2-(4-chloro-3-methylphenoxy)acetyl]-(pyridin-4-ylmethyl)amino]benzoate.
| Compound Name | ethyl 4-[[2-(4-chloro-3-methylphenoxy)acetyl]-(pyridin-4-ylmethyl)amino]benzoate |
|---|---|
| PubChem CID | 22780966 |
| Molecular Formula | C24H23ClN2O4 |
| Molecular Weight | 438.91 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | ethyl 4-[[2-(4-chloro-3-methylphenoxy)acetyl]-(pyridin-4-ylmethyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(N(Cc2ccncc2)C(=O)COc2ccc(Cl)c(C)c2)cc1 |
| InChI | InChI=1S/C24H23ClN2O4/c1-3-30-24(29)19-4-6-20(7-5-19)27(15-18-10-12-26-13-11-18)23(28)16-31-21-8-9-22(25)17(2)14-21/h4-14H,3,15-16H2,1-2H3 |
| InChIKey | HJRJMRWSGCJFPG-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.91 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |