C22H19ClN2O3 — CID 19630476
ethyl 4-[(3-chlorobenzoyl)-(pyridin-4-ylmethyl)amino]benzoate (PubChem CID 19630476) has the molecular formula C22H19ClN2O3 and a molecular weight of 394.86 g/mol. Its IUPAC name is ethyl 4-[(3-chlorobenzoyl)-(pyridin-4-ylmethyl)amino]benzoate.
| Compound Name | ethyl 4-[(3-chlorobenzoyl)-(pyridin-4-ylmethyl)amino]benzoate |
|---|---|
| PubChem CID | 19630476 |
| Molecular Formula | C22H19ClN2O3 |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | ethyl 4-[(3-chlorobenzoyl)-(pyridin-4-ylmethyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(N(Cc2ccncc2)C(=O)c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C22H19ClN2O3/c1-2-28-22(27)17-6-8-20(9-7-17)25(15-16-10-12-24-13-11-16)21(26)18-4-3-5-19(23)14-18/h3-14H,2,15H2,1H3 |
| InChIKey | DXHWXNUAJNBUOX-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |