C27H29N3O3S — CID 23097355
ethyl 4-[(4-tert-butylbenzoyl)carbamothioyl-(pyridin-4-ylmethyl)amino]benzoate (PubChem CID 23097355) has the molecular formula C27H29N3O3S and a molecular weight of 475.61 g/mol. Its IUPAC name is ethyl 4-[(4-tert-butylbenzoyl)carbamothioyl-(pyridin-4-ylmethyl)amino]benzoate.
| Compound Name | ethyl 4-[(4-tert-butylbenzoyl)carbamothioyl-(pyridin-4-ylmethyl)amino]benzoate |
|---|---|
| PubChem CID | 23097355 |
| Molecular Formula | C27H29N3O3S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | ethyl 4-[(4-tert-butylbenzoyl)carbamothioyl-(pyridin-4-ylmethyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(N(Cc2ccncc2)C(=S)NC(=O)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C27H29N3O3S/c1-5-33-25(32)21-8-12-23(13-9-21)30(18-19-14-16-28-17-15-19)26(34)29-24(31)20-6-10-22(11-7-20)27(2,3)4/h6-17H,5,18H2,1-4H3,(H,29,31,34) |
| InChIKey | KGABXKOEZSZJPM-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|