C26H24Cl2N2O3S — CID 23101489
ethyl 4-[(2,4-dichlorophenyl)methyl-[(3,4-dimethylbenzoyl)carbamothioyl]amino]benzoate (PubChem CID 23101489) has the molecular formula C26H24Cl2N2O3S and a molecular weight of 515.46 g/mol. Its IUPAC name is ethyl 4-[(2,4-dichlorophenyl)methyl-[(3,4-dimethylbenzoyl)carbamothioyl]amino]benzoate.
| Compound Name | ethyl 4-[(2,4-dichlorophenyl)methyl-[(3,4-dimethylbenzoyl)carbamothioyl]amino]benzoate |
|---|---|
| PubChem CID | 23101489 |
| Molecular Formula | C26H24Cl2N2O3S |
| Molecular Weight | 515.46 g/mol |
| Exact Mass | 514.09 |
| IUPAC Name | ethyl 4-[(2,4-dichlorophenyl)methyl-[(3,4-dimethylbenzoyl)carbamothioyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(N(Cc2ccc(Cl)cc2Cl)C(=S)NC(=O)c2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C26H24Cl2N2O3S/c1-4-33-25(32)18-8-11-22(12-9-18)30(15-20-7-10-21(27)14-23(20)28)26(34)29-24(31)19-6-5-16(2)17(3)13-19/h5-14H,4,15H2,1-3H3,(H,29,31,34) |
| InChIKey | LZBVOTAIWADIIJ-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.46 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|