C28H21Cl3N2O3S — CID 21170629
ethyl 4-[(5-chloronaphthalene-1-carbonyl)carbamothioyl-[(2,4-dichlorophenyl)methyl]amino]benzoate (PubChem CID 21170629) has the molecular formula C28H21Cl3N2O3S and a molecular weight of 571.91 g/mol. Its IUPAC name is ethyl 4-[(5-chloronaphthalene-1-carbonyl)carbamothioyl-[(2,4-dichlorophenyl)methyl]amino]benzoate.
| Compound Name | ethyl 4-[(5-chloronaphthalene-1-carbonyl)carbamothioyl-[(2,4-dichlorophenyl)methyl]amino]benzoate |
|---|---|
| PubChem CID | 21170629 |
| Molecular Formula | C28H21Cl3N2O3S |
| Molecular Weight | 571.91 g/mol |
| Exact Mass | 570.03 |
| IUPAC Name | ethyl 4-[(5-chloronaphthalene-1-carbonyl)carbamothioyl-[(2,4-dichlorophenyl)methyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(N(Cc2ccc(Cl)cc2Cl)C(=S)NC(=O)c2cccc3c(Cl)cccc23)cc1 |
| InChI | InChI=1S/C28H21Cl3N2O3S/c1-2-36-27(35)17-10-13-20(14-11-17)33(16-18-9-12-19(29)15-25(18)31)28(37)32-26(34)23-7-3-6-22-21(23)5-4-8-24(22)30/h3-15H,2,16H2,1H3,(H,32,34,37) |
| InChIKey | RFKORUYMSGUMAT-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.91 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|