C25H21Cl3N2O4S — CID 21169679
ethyl 4-[(5-chloro-2-methoxybenzoyl)carbamothioyl-[(2,4-dichlorophenyl)methyl]amino]benzoate (PubChem CID 21169679) has the molecular formula C25H21Cl3N2O4S and a molecular weight of 551.88 g/mol. Its IUPAC name is ethyl 4-[(5-chloro-2-methoxybenzoyl)carbamothioyl-[(2,4-dichlorophenyl)methyl]amino]benzoate.
| Compound Name | ethyl 4-[(5-chloro-2-methoxybenzoyl)carbamothioyl-[(2,4-dichlorophenyl)methyl]amino]benzoate |
|---|---|
| PubChem CID | 21169679 |
| Molecular Formula | C25H21Cl3N2O4S |
| Molecular Weight | 551.88 g/mol |
| Exact Mass | 550.03 |
| IUPAC Name | ethyl 4-[(5-chloro-2-methoxybenzoyl)carbamothioyl-[(2,4-dichlorophenyl)methyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(N(Cc2ccc(Cl)cc2Cl)C(=S)NC(=O)c2cc(Cl)ccc2OC)cc1 |
| InChI | InChI=1S/C25H21Cl3N2O4S/c1-3-34-24(32)15-5-9-19(10-6-15)30(14-16-4-7-18(27)13-21(16)28)25(35)29-23(31)20-12-17(26)8-11-22(20)33-2/h4-13H,3,14H2,1-2H3,(H,29,31,35) |
| InChIKey | GLFWJGDTDHRXRG-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.88 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|