C23H17Cl3INO3 — CID 21171158
ethyl 4-[(2-chloro-5-iodobenzoyl)-[(2,4-dichlorophenyl)methyl]amino]benzoate (PubChem CID 21171158) has the molecular formula C23H17Cl3INO3 and a molecular weight of 588.66 g/mol. Its IUPAC name is ethyl 4-[(2-chloro-5-iodobenzoyl)-[(2,4-dichlorophenyl)methyl]amino]benzoate.
| Compound Name | ethyl 4-[(2-chloro-5-iodobenzoyl)-[(2,4-dichlorophenyl)methyl]amino]benzoate |
|---|---|
| PubChem CID | 21171158 |
| Molecular Formula | C23H17Cl3INO3 |
| Molecular Weight | 588.66 g/mol |
| Exact Mass | 586.93 |
| IUPAC Name | ethyl 4-[(2-chloro-5-iodobenzoyl)-[(2,4-dichlorophenyl)methyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(N(Cc2ccc(Cl)cc2Cl)C(=O)c2cc(I)ccc2Cl)cc1 |
| InChI | InChI=1S/C23H17Cl3INO3/c1-2-31-23(30)14-4-8-18(9-5-14)28(13-15-3-6-16(24)11-21(15)26)22(29)19-12-17(27)7-10-20(19)25/h3-12H,2,13H2,1H3 |
| InChIKey | PLPUSYOHCUEVGR-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.66 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|