C25H21Cl3N2O3S — CID 21168704
ethyl 4-[[2-(4-chlorophenyl)acetyl]carbamothioyl-[(2,4-dichlorophenyl)methyl]amino]benzoate (PubChem CID 21168704) has the molecular formula C25H21Cl3N2O3S and a molecular weight of 535.88 g/mol. Its IUPAC name is ethyl 4-[[2-(4-chlorophenyl)acetyl]carbamothioyl-[(2,4-dichlorophenyl)methyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-(4-chlorophenyl)acetyl]carbamothioyl-[(2,4-dichlorophenyl)methyl]amino]benzoate |
|---|---|
| PubChem CID | 21168704 |
| Molecular Formula | C25H21Cl3N2O3S |
| Molecular Weight | 535.88 g/mol |
| Exact Mass | 534.03 |
| IUPAC Name | ethyl 4-[[2-(4-chlorophenyl)acetyl]carbamothioyl-[(2,4-dichlorophenyl)methyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(N(Cc2ccc(Cl)cc2Cl)C(=S)NC(=O)Cc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C25H21Cl3N2O3S/c1-2-33-24(32)17-6-11-21(12-7-17)30(15-18-5-10-20(27)14-22(18)28)25(34)29-23(31)13-16-3-8-19(26)9-4-16/h3-12,14H,2,13,15H2,1H3,(H,29,31,34) |
| InChIKey | UMZVXRHGRGEVKW-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.88 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|